C21H16N4O — CID 86670619
5-phenyl-4-(pyridin-2-ylmethylamino)quinazoline-2-carbaldehyde (PubChem CID 86670619) has the molecular formula C21H16N4O and a molecular weight of 340.39 g/mol. Its IUPAC name is 5-phenyl-4-(pyridin-2-ylmethylamino)quinazoline-2-carbaldehyde.
| Compound Name | 5-phenyl-4-(pyridin-2-ylmethylamino)quinazoline-2-carbaldehyde |
|---|---|
| PubChem CID | 86670619 |
| Molecular Formula | C21H16N4O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 5-phenyl-4-(pyridin-2-ylmethylamino)quinazoline-2-carbaldehyde |
| SMILES | O=Cc1nc(NCc2ccccn2)c2c(-c3ccccc3)cccc2n1 |
| InChI | InChI=1S/C21H16N4O/c26-14-19-24-18-11-6-10-17(15-7-2-1-3-8-15)20(18)21(25-19)23-13-16-9-4-5-12-22-16/h1-12,14H,13H2,(H,23,24,25) |
| InChIKey | LMAAGJCVQNQAOB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|