C23H20N4 — CID 126518660
5-phenyl-2-[(E)-prop-1-enyl]-N-(pyridin-2-ylmethyl)quinazolin-4-amine (PubChem CID 126518660) has the molecular formula C23H20N4 and a molecular weight of 352.44 g/mol. Its IUPAC name is 5-phenyl-2-[(E)-prop-1-enyl]-N-(pyridin-2-ylmethyl)quinazolin-4-amine.
| Compound Name | 5-phenyl-2-[(E)-prop-1-enyl]-N-(pyridin-2-ylmethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 126518660 |
| Molecular Formula | C23H20N4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 5-phenyl-2-[(E)-prop-1-enyl]-N-(pyridin-2-ylmethyl)quinazolin-4-amine |
| SMILES | C/C=C/c1nc(NCc2ccccn2)c2c(-c3ccccc3)cccc2n1 |
| InChI | InChI=1S/C23H20N4/c1-2-9-21-26-20-14-8-13-19(17-10-4-3-5-11-17)22(20)23(27-21)25-16-18-12-6-7-15-24-18/h2-15H,16H2,1H3,(H,25,26,27)/b9-2+ |
| InChIKey | XNMGGHODSRUTIR-XNWCZRBMSA-N |
| XLogP | 5.34 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |