C27H22N4O2S — CID 118659367
4-[8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-3-yl]benzenesulfonamide (PubChem CID 118659367) has the molecular formula C27H22N4O2S and a molecular weight of 466.57 g/mol. Its IUPAC name is 4-[8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-3-yl]benzenesulfonamide.
| Compound Name | 4-[8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 118659367 |
| Molecular Formula | C27H22N4O2S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 4-[8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-3-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2cc3cccc(-c4ccccc4)c3c(NCc3ccccn3)n2)cc1 |
| InChI | InChI=1S/C27H22N4O2S/c28-34(32,33)23-14-12-20(13-15-23)25-17-21-9-6-11-24(19-7-2-1-3-8-19)26(21)27(31-25)30-18-22-10-4-5-16-29-22/h1-17H,18H2,(H,30,31)(H2,28,32,33) |
| InChIKey | UAKADZQUCJEHSJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |