C31H31N5O2S — CID 90425098
N-butyl-5-[4-methyl-8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-3-yl]pyridine-3-sulfonamide (PubChem CID 90425098) has the molecular formula C31H31N5O2S and a molecular weight of 537.69 g/mol. Its IUPAC name is N-butyl-5-[4-methyl-8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-3-yl]pyridine-3-sulfonamide.
| Compound Name | N-butyl-5-[4-methyl-8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-3-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 90425098 |
| Molecular Formula | C31H31N5O2S |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | N-butyl-5-[4-methyl-8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-3-yl]pyridine-3-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1cncc(-c2nc(NCc3ccccn3)c3c(-c4ccccc4)cccc3c2C)c1 |
| InChI | InChI=1S/C31H31N5O2S/c1-3-4-17-35-39(37,38)26-18-24(19-32-21-26)30-22(2)27-14-10-15-28(23-11-6-5-7-12-23)29(27)31(36-30)34-20-25-13-8-9-16-33-25/h5-16,18-19,21,35H,3-4,17,20H2,1-2H3,(H,34,36) |
| InChIKey | HJDOLYBZBXFRRD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|