C27H22N6 — CID 118679911
4-[5-(1-aminoethenyl)-3-pyridinyl]-8-phenyl-N-(pyridin-2-ylmethyl)phthalazin-1-amine (PubChem CID 118679911) has the molecular formula C27H22N6 and a molecular weight of 430.52 g/mol. Its IUPAC name is 4-[5-(1-aminoethenyl)-3-pyridinyl]-8-phenyl-N-(pyridin-2-ylmethyl)phthalazin-1-amine.
| Compound Name | 4-[5-(1-aminoethenyl)-3-pyridinyl]-8-phenyl-N-(pyridin-2-ylmethyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 118679911 |
| Molecular Formula | C27H22N6 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4-[5-(1-aminoethenyl)-3-pyridinyl]-8-phenyl-N-(pyridin-2-ylmethyl)phthalazin-1-amine |
| SMILES | C=C(N)c1cncc(-c2nnc(NCc3ccccn3)c3c(-c4ccccc4)cccc23)c1 |
| InChI | InChI=1S/C27H22N6/c1-18(28)20-14-21(16-29-15-20)26-24-12-7-11-23(19-8-3-2-4-9-19)25(24)27(33-32-26)31-17-22-10-5-6-13-30-22/h2-16H,1,17,28H2,(H,31,33) |
| InChIKey | FZUZDSQKIDJFHP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |