C26H21N5 — CID 86267455
4-(6-amino-3-pyridinyl)-N-benzyl-8-phenylphthalazin-1-amine (PubChem CID 86267455) has the molecular formula C26H21N5 and a molecular weight of 403.49 g/mol. Its IUPAC name is 4-(6-amino-3-pyridinyl)-N-benzyl-8-phenylphthalazin-1-amine.
| Compound Name | 4-(6-amino-3-pyridinyl)-N-benzyl-8-phenylphthalazin-1-amine |
|---|---|
| PubChem CID | 86267455 |
| Molecular Formula | C26H21N5 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 4-(6-amino-3-pyridinyl)-N-benzyl-8-phenylphthalazin-1-amine |
| SMILES | Nc1ccc(-c2nnc(NCc3ccccc3)c3c(-c4ccccc4)cccc23)cn1 |
| InChI | InChI=1S/C26H21N5/c27-23-15-14-20(17-28-23)25-22-13-7-12-21(19-10-5-2-6-11-19)24(22)26(31-30-25)29-16-18-8-3-1-4-9-18/h1-15,17H,16H2,(H2,27,28)(H,29,31) |
| InChIKey | NVCZHACLFAOCAL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |