C21H23N3O5 — CID 10272121
N-(3,5-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine (PubChem CID 10272121) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 10272121 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine |
| SMILES | COc1cc(Nc2nccc(-c3cc(OC)c(OC)c(OC)c3)n2)cc(OC)c1 |
| InChI | InChI=1S/C21H23N3O5/c1-25-15-10-14(11-16(12-15)26-2)23-21-22-7-6-17(24-21)13-8-18(27-3)20(29-5)19(9-13)28-4/h6-12H,1-5H3,(H,22,23,24) |
| InChIKey | RRZYFGJNORBVQA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |