C16H17N5O3S — CID 87365127
5-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine (PubChem CID 87365127) has the molecular formula C16H17N5O3S and a molecular weight of 359.41 g/mol. Its IUPAC name is 5-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 5-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87365127 |
| Molecular Formula | C16H17N5O3S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 5-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine |
| SMILES | COc1cc(Nc2nccc(-c3cnc(N)s3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C16H17N5O3S/c1-22-11-6-9(7-12(23-2)14(11)24-3)20-16-18-5-4-10(21-16)13-8-19-15(17)25-13/h4-8H,1-3H3,(H2,17,19)(H,18,20,21) |
| InChIKey | NBMUQTSRPYZDQH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |