C14H17N5O4 — CID 151561300
[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]urea (PubChem CID 151561300) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is [2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]urea.
| Compound Name | [2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 151561300 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | [2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]urea |
| SMILES | COc1cc(Nc2nccc(NC(N)=O)n2)cc(OC)c1OC |
| InChI | InChI=1S/C14H17N5O4/c1-21-9-6-8(7-10(22-2)12(9)23-3)17-14-16-5-4-11(19-14)18-13(15)20/h4-7H,1-3H3,(H4,15,16,17,18,19,20) |
| InChIKey | QCNDSHOWOSBGDZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |