C18H24N4O3 — CID 112884414
2-N-cyclopentyl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 112884414) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-N-cyclopentyl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-cyclopentyl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112884414 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-N-cyclopentyl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2ccnc(NC3CCCC3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C18H24N4O3/c1-23-14-10-13(11-15(24-2)17(14)25-3)20-16-8-9-19-18(22-16)21-12-6-4-5-7-12/h8-12H,4-7H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | KZWWZUWQICVEDW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |