C25H36N7O3+ — CID 18545621
N-methylmethanamine;4-[6-(1-methylpiperazin-1-ium-1-yl)-3-pyridinyl]-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine (PubChem CID 18545621) has the molecular formula C25H36N7O3+ and a molecular weight of 482.61 g/mol. Its IUPAC name is N-methylmethanamine;4-[6-(1-methylpiperazin-1-ium-1-yl)-3-pyridinyl]-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine.
| Compound Name | N-methylmethanamine;4-[6-(1-methylpiperazin-1-ium-1-yl)-3-pyridinyl]-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 18545621 |
| Molecular Formula | C25H36N7O3+ |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | N-methylmethanamine;4-[6-(1-methylpiperazin-1-ium-1-yl)-3-pyridinyl]-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine |
| SMILES | CNC.COc1cc(Nc2nccc(-c3ccc([N+]4(C)CCNCC4)nc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H29N6O3.C2H7N/c1-29(11-9-24-10-12-29)21-6-5-16(15-26-21)18-7-8-25-23(28-18)27-17-13-19(30-2)22(32-4)20(14-17)31-3;1-3-2/h5-8,13-15,24H,9-12H2,1-4H3,(H,25,27,28);3H,1-2H3/q+1; |
| InChIKey | DOOBBOHAZNBYIE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|