C18H18BrN5O3S — CID 58890907
4-[[5-bromo-4-[(4-methoxyphenyl)methylamino]pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 58890907) has the molecular formula C18H18BrN5O3S and a molecular weight of 464.35 g/mol. Its IUPAC name is 4-[[5-bromo-4-[(4-methoxyphenyl)methylamino]pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[5-bromo-4-[(4-methoxyphenyl)methylamino]pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 58890907 |
| Molecular Formula | C18H18BrN5O3S |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 4-[[5-bromo-4-[(4-methoxyphenyl)methylamino]pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | COc1ccc(CNc2nc(Nc3ccc(S(N)(=O)=O)cc3)ncc2Br)cc1 |
| InChI | InChI=1S/C18H18BrN5O3S/c1-27-14-6-2-12(3-7-14)10-21-17-16(19)11-22-18(24-17)23-13-4-8-15(9-5-13)28(20,25)26/h2-9,11H,10H2,1H3,(H2,20,25,26)(H2,21,22,23,24) |
| InChIKey | YZNKBOPXCBPXQL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |