C22H25BrN6O4S2 — CID 91610973
N-[2-[[5-bromo-2-[4-[[(4-methoxyphenyl)sulfonylamino]-methylidene-λ4-sulfanyl]anilino]pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 91610973) has the molecular formula C22H25BrN6O4S2 and a molecular weight of 581.52 g/mol. Its IUPAC name is N-[2-[[5-bromo-2-[4-[[(4-methoxyphenyl)sulfonylamino]-methylidene-λ4-sulfanyl]anilino]pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[5-bromo-2-[4-[[(4-methoxyphenyl)sulfonylamino]-methylidene-λ4-sulfanyl]anilino]pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 91610973 |
| Molecular Formula | C22H25BrN6O4S2 |
| Molecular Weight | 581.52 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | N-[2-[[5-bromo-2-[4-[[(4-methoxyphenyl)sulfonylamino]-methylidene-λ4-sulfanyl]anilino]pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | C=S(NS(=O)(=O)c1ccc(OC)cc1)c1ccc(Nc2ncc(Br)c(NCCNC(C)=O)n2)cc1 |
| InChI | InChI=1S/C22H25BrN6O4S2/c1-15(30)24-12-13-25-21-20(23)14-26-22(28-21)27-16-4-8-18(9-5-16)34(3)29-35(31,32)19-10-6-17(33-2)7-11-19/h4-11,14,29H,3,12-13H2,1-2H3,(H,24,30)(H2,25,26,27,28) |
| InChIKey | WRBIRDKXBYNGEN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 134.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|