C17H22BrN5O4S — CID 58891111
[(2R)-2-[[5-bromo-2-(4-sulfamoylanilino)pyrimidin-4-yl]amino]-3-methylbutyl] acetate (PubChem CID 58891111) has the molecular formula C17H22BrN5O4S and a molecular weight of 472.37 g/mol. Its IUPAC name is [(2R)-2-[[5-bromo-2-(4-sulfamoylanilino)pyrimidin-4-yl]amino]-3-methylbutyl] acetate.
| Compound Name | [(2R)-2-[[5-bromo-2-(4-sulfamoylanilino)pyrimidin-4-yl]amino]-3-methylbutyl] acetate |
|---|---|
| PubChem CID | 58891111 |
| Molecular Formula | C17H22BrN5O4S |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | [(2R)-2-[[5-bromo-2-(4-sulfamoylanilino)pyrimidin-4-yl]amino]-3-methylbutyl] acetate |
| SMILES | CC(=O)OC[C@H](Nc1nc(Nc2ccc(S(N)(=O)=O)cc2)ncc1Br)C(C)C |
| InChI | InChI=1S/C17H22BrN5O4S/c1-10(2)15(9-27-11(3)24)22-16-14(18)8-20-17(23-16)21-12-4-6-13(7-5-12)28(19,25)26/h4-8,10,15H,9H2,1-3H3,(H2,19,25,26)(H2,20,21,22,23)/t15-/m0/s1 |
| InChIKey | HXWVARUJJXRLFD-HNNXBMFYSA-N |
| XLogP | 2.63 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |