C16H22BrN5O2S — CID 91305721
3-[[2-[4-(amino-ethylidene-oxo-λ6-sulfanyl)anilino]-5-bromopyrimidin-4-yl]amino]butan-2-ol (PubChem CID 91305721) has the molecular formula C16H22BrN5O2S and a molecular weight of 428.36 g/mol. Its IUPAC name is 3-[[2-[4-(amino-ethylidene-oxo-λ6-sulfanyl)anilino]-5-bromopyrimidin-4-yl]amino]butan-2-ol.
| Compound Name | 3-[[2-[4-(amino-ethylidene-oxo-λ6-sulfanyl)anilino]-5-bromopyrimidin-4-yl]amino]butan-2-ol |
|---|---|
| PubChem CID | 91305721 |
| Molecular Formula | C16H22BrN5O2S |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 3-[[2-[4-(amino-ethylidene-oxo-λ6-sulfanyl)anilino]-5-bromopyrimidin-4-yl]amino]butan-2-ol |
| SMILES | CC=S(N)(=O)c1ccc(Nc2ncc(Br)c(NC(C)C(C)O)n2)cc1 |
| InChI | InChI=1S/C16H22BrN5O2S/c1-4-25(18,24)13-7-5-12(6-8-13)21-16-19-9-14(17)15(22-16)20-10(2)11(3)23/h4-11,23H,1-3H3,(H2,18,24)(H2,19,20,21,22) |
| InChIKey | ZXVDCRRZIASKES-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|