C16H20F3N5O2S — CID 123663133
3-[[2-[4-(amino-methylidene-oxo-λ6-sulfanyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]butan-2-ol (PubChem CID 123663133) has the molecular formula C16H20F3N5O2S and a molecular weight of 403.43 g/mol. Its IUPAC name is 3-[[2-[4-(amino-methylidene-oxo-λ6-sulfanyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]butan-2-ol.
| Compound Name | 3-[[2-[4-(amino-methylidene-oxo-λ6-sulfanyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]butan-2-ol |
|---|---|
| PubChem CID | 123663133 |
| Molecular Formula | C16H20F3N5O2S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 3-[[2-[4-(amino-methylidene-oxo-λ6-sulfanyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]butan-2-ol |
| SMILES | C=S(N)(=O)c1ccc(Nc2ncc(C(F)(F)F)c(NC(C)C(C)O)n2)cc1 |
| InChI | InChI=1S/C16H20F3N5O2S/c1-9(10(2)25)22-14-13(16(17,18)19)8-21-15(24-14)23-11-4-6-12(7-5-11)27(3,20)26/h4-10,25H,3H2,1-2H3,(H2,20,26)(H2,21,22,23,24) |
| InChIKey | CAYHLLYJZCPLMV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|