C13H16BrN5O4S — CID 58751557
4-[[5-bromo-4-[(2-hydroxy-1-methoxyethyl)amino]pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 58751557) has the molecular formula C13H16BrN5O4S and a molecular weight of 418.27 g/mol. Its IUPAC name is 4-[[5-bromo-4-[(2-hydroxy-1-methoxyethyl)amino]pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[5-bromo-4-[(2-hydroxy-1-methoxyethyl)amino]pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 58751557 |
| Molecular Formula | C13H16BrN5O4S |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 4-[[5-bromo-4-[(2-hydroxy-1-methoxyethyl)amino]pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | COC(CO)Nc1nc(Nc2ccc(S(N)(=O)=O)cc2)ncc1Br |
| InChI | InChI=1S/C13H16BrN5O4S/c1-23-11(7-20)18-12-10(14)6-16-13(19-12)17-8-2-4-9(5-3-8)24(15,21)22/h2-6,11,20H,7H2,1H3,(H2,15,21,22)(H2,16,17,18,19) |
| InChIKey | JNYHSSMCEKBVMX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|