C23H27FN8O2S — CID 162360393
4-[(10-cyclopropyl-12-methyliminospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]-2-fluorobenzenesulfonamide (PubChem CID 162360393) has the molecular formula C23H27FN8O2S and a molecular weight of 498.59 g/mol. Its IUPAC name is 4-[(10-cyclopropyl-12-methyliminospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]-2-fluorobenzenesulfonamide.
| Compound Name | 4-[(10-cyclopropyl-12-methyliminospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 162360393 |
| Molecular Formula | C23H27FN8O2S |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 4-[(10-cyclopropyl-12-methyliminospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]-2-fluorobenzenesulfonamide |
| SMILES | C/N=C1\NN(C2CC2)c2cc3cnc(Nc4ccc(S(N)(=O)=O)c(F)c4)nc3n2C12CCCCC2 |
| InChI | InChI=1S/C23H27FN8O2S/c1-26-21-23(9-3-2-4-10-23)31-19(32(30-21)16-6-7-16)11-14-13-27-22(29-20(14)31)28-15-5-8-18(17(24)12-15)35(25,33)34/h5,8,11-13,16H,2-4,6-7,9-10H2,1H3,(H,26,30)(H2,25,33,34)(H,27,28,29) |
| InChIKey | ANGPVSPSDASBSA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 130.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|