C24H30N8O3S — CID 162360030
N-[10-ethyl-4-(4-sulfamoylanilino)spiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-12-yl]-N-methylacetamide (PubChem CID 162360030) has the molecular formula C24H30N8O3S and a molecular weight of 510.62 g/mol. Its IUPAC name is N-[10-ethyl-4-(4-sulfamoylanilino)spiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-12-yl]-N-methylacetamide.
| Compound Name | N-[10-ethyl-4-(4-sulfamoylanilino)spiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-12-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 162360030 |
| Molecular Formula | C24H30N8O3S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | N-[10-ethyl-4-(4-sulfamoylanilino)spiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-12-yl]-N-methylacetamide |
| SMILES | CCN1N=C(N(C)C(C)=O)C2(CCCCC2)n2c1cc1cnc(Nc3ccc(S(N)(=O)=O)cc3)nc12 |
| InChI | InChI=1S/C24H30N8O3S/c1-4-31-20-14-17-15-26-23(27-18-8-10-19(11-9-18)36(25,34)35)28-21(17)32(20)24(12-6-5-7-13-24)22(29-31)30(3)16(2)33/h8-11,14-15H,4-7,12-13H2,1-3H3,(H2,25,34,35)(H,26,27,28) |
| InChIKey | HAFQTGVDKCQLDI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 138.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |