C21H25N7O2S — CID 162360198
4-amino-N-(10,12-dimethylspiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-yl)benzenesulfonamide (PubChem CID 162360198) has the molecular formula C21H25N7O2S and a molecular weight of 439.55 g/mol. Its IUPAC name is 4-amino-N-(10,12-dimethylspiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-(10,12-dimethylspiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 162360198 |
| Molecular Formula | C21H25N7O2S |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 4-amino-N-(10,12-dimethylspiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-yl)benzenesulfonamide |
| SMILES | CC1=NN(C)c2cc3cnc(NS(=O)(=O)c4ccc(N)cc4)nc3n2C12CCCCC2 |
| InChI | InChI=1S/C21H25N7O2S/c1-14-21(10-4-3-5-11-21)28-18(27(2)25-14)12-15-13-23-20(24-19(15)28)26-31(29,30)17-8-6-16(22)7-9-17/h6-9,12-13H,3-5,10-11,22H2,1-2H3,(H,23,24,26) |
| InChIKey | HIGLFGKBSIFQNW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 118.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|