C12H13ClN4O3S — CID 154127675
4-amino-N-(4-chloro-5-ethoxypyrimidin-2-yl)benzenesulfonamide (PubChem CID 154127675) has the molecular formula C12H13ClN4O3S and a molecular weight of 328.78 g/mol. Its IUPAC name is 4-amino-N-(4-chloro-5-ethoxypyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-(4-chloro-5-ethoxypyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 154127675 |
| Molecular Formula | C12H13ClN4O3S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 4-amino-N-(4-chloro-5-ethoxypyrimidin-2-yl)benzenesulfonamide |
| SMILES | CCOc1cnc(NS(=O)(=O)c2ccc(N)cc2)nc1Cl |
| InChI | InChI=1S/C12H13ClN4O3S/c1-2-20-10-7-15-12(16-11(10)13)17-21(18,19)9-5-3-8(14)4-6-9/h3-7H,2,14H2,1H3,(H,15,16,17) |
| InChIKey | ZTQDORFBGHGELC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|