C13H16N4O4S — CID 3616965
4-amino-N-(5-ethoxy-4-methoxypyrimidin-2-yl)benzenesulfonamide (PubChem CID 3616965) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is 4-amino-N-(5-ethoxy-4-methoxypyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-(5-ethoxy-4-methoxypyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3616965 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 4-amino-N-(5-ethoxy-4-methoxypyrimidin-2-yl)benzenesulfonamide |
| SMILES | CCOc1cnc(NS(=O)(=O)c2ccc(N)cc2)nc1OC |
| InChI | InChI=1S/C13H16N4O4S/c1-3-21-11-8-15-13(16-12(11)20-2)17-22(18,19)10-6-4-9(14)5-7-10/h4-8H,3,14H2,1-2H3,(H,15,16,17) |
| InChIKey | OFVFPQRIJUCEIP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|