C13H17N5O3S — CID 165350307
4-amino-N-(4-methoxy-6-propyl-1,3,5-triazin-2-yl)benzenesulfonamide (PubChem CID 165350307) has the molecular formula C13H17N5O3S and a molecular weight of 323.38 g/mol. Its IUPAC name is 4-amino-N-(4-methoxy-6-propyl-1,3,5-triazin-2-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-(4-methoxy-6-propyl-1,3,5-triazin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 165350307 |
| Molecular Formula | C13H17N5O3S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-amino-N-(4-methoxy-6-propyl-1,3,5-triazin-2-yl)benzenesulfonamide |
| SMILES | CCCc1nc(NS(=O)(=O)c2ccc(N)cc2)nc(OC)n1 |
| InChI | InChI=1S/C13H17N5O3S/c1-3-4-11-15-12(17-13(16-11)21-2)18-22(19,20)10-7-5-9(14)6-8-10/h5-8H,3-4,14H2,1-2H3,(H,15,16,17,18) |
| InChIKey | CVUWJGFYKNHOCQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|