C22H26N8O3S — CID 165172537
6-[(10-cyclopropyl-12-methoxyspiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-yl)amino]pyridine-3-sulfonamide (PubChem CID 165172537) has the molecular formula C22H26N8O3S and a molecular weight of 482.57 g/mol. Its IUPAC name is 6-[(10-cyclopropyl-12-methoxyspiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-yl)amino]pyridine-3-sulfonamide.
| Compound Name | 6-[(10-cyclopropyl-12-methoxyspiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-yl)amino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 165172537 |
| Molecular Formula | C22H26N8O3S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 6-[(10-cyclopropyl-12-methoxyspiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-yl)amino]pyridine-3-sulfonamide |
| SMILES | COC1=NN(C2CC2)c2cc3cnc(Nc4ccc(S(N)(=O)=O)cn4)nc3n2C12CCCCC2 |
| InChI | InChI=1S/C22H26N8O3S/c1-33-20-22(9-3-2-4-10-22)29-18(30(28-20)15-5-6-15)11-14-12-25-21(27-19(14)29)26-17-8-7-16(13-24-17)34(23,31)32/h7-8,11-13,15H,2-6,9-10H2,1H3,(H2,23,31,32)(H,24,25,26,27) |
| InChIKey | AADYRWHBQVXSOV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |