C21H26N8O3S — CID 162360240
5-[(10-ethyl-12-methoxyspiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-yl)amino]pyridine-2-sulfonamide (PubChem CID 162360240) has the molecular formula C21H26N8O3S and a molecular weight of 470.56 g/mol. Its IUPAC name is 5-[(10-ethyl-12-methoxyspiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-yl)amino]pyridine-2-sulfonamide.
| Compound Name | 5-[(10-ethyl-12-methoxyspiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-yl)amino]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 162360240 |
| Molecular Formula | C21H26N8O3S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 5-[(10-ethyl-12-methoxyspiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-yl)amino]pyridine-2-sulfonamide |
| SMILES | CCN1N=C(OC)C2(CCCCC2)n2c1cc1cnc(Nc3ccc(S(N)(=O)=O)nc3)nc12 |
| InChI | InChI=1S/C21H26N8O3S/c1-3-28-17-11-14-12-24-20(25-15-7-8-16(23-13-15)33(22,30)31)26-18(14)29(17)21(19(27-28)32-2)9-5-4-6-10-21/h7-8,11-13H,3-6,9-10H2,1-2H3,(H2,22,30,31)(H,24,25,26) |
| InChIKey | WXKQIHTYNBEPGL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |