C25H29N7O2 — CID 162360217
4-[4-(piperazine-1-carbonyl)anilino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one (PubChem CID 162360217) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-[4-(piperazine-1-carbonyl)anilino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one.
| Compound Name | 4-[4-(piperazine-1-carbonyl)anilino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one |
|---|---|
| PubChem CID | 162360217 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 4-[4-(piperazine-1-carbonyl)anilino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one |
| SMILES | O=C1NCC2(CCCCC2)n2c1cc1cnc(Nc3ccc(C(=O)N4CCNCC4)cc3)nc12 |
| InChI | InChI=1S/C25H29N7O2/c33-22-20-14-18-15-27-24(30-21(18)32(20)25(16-28-22)8-2-1-3-9-25)29-19-6-4-17(5-7-19)23(34)31-12-10-26-11-13-31/h4-7,14-15,26H,1-3,8-13,16H2,(H,28,33)(H,27,29,30) |
| InChIKey | BKCOGSHTNWTZNI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |