C16H18N6O3 — CID 71061374
9-[(1R,3S)-3-hydroxycyclohexyl]-2-[(2-oxo-1H-pyridin-3-yl)amino]-7H-purin-8-one (PubChem CID 71061374) has the molecular formula C16H18N6O3 and a molecular weight of 342.36 g/mol. Its IUPAC name is 9-[(1R,3S)-3-hydroxycyclohexyl]-2-[(2-oxo-1H-pyridin-3-yl)amino]-7H-purin-8-one.
| Compound Name | 9-[(1R,3S)-3-hydroxycyclohexyl]-2-[(2-oxo-1H-pyridin-3-yl)amino]-7H-purin-8-one |
|---|---|
| PubChem CID | 71061374 |
| Molecular Formula | C16H18N6O3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 9-[(1R,3S)-3-hydroxycyclohexyl]-2-[(2-oxo-1H-pyridin-3-yl)amino]-7H-purin-8-one |
| SMILES | O=c1[nH]cccc1Nc1ncc2[nH]c(=O)n([C@@H]3CCC[C@H](O)C3)c2n1 |
| InChI | InChI=1S/C16H18N6O3/c23-10-4-1-3-9(7-10)22-13-12(20-16(22)25)8-18-15(21-13)19-11-5-2-6-17-14(11)24/h2,5-6,8-10,23H,1,3-4,7H2,(H,17,24)(H,20,25)(H,18,19,21)/t9-,10+/m1/s1 |
| InChIKey | AMYVYKVEHRUCPS-ZJUUUORDSA-N |
| XLogP | 1.03 |
| TPSA | 128.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |