C21H25FN6O3 — CID 118620629
tert-butyl (3R)-3-[2-(4-fluoroanilino)-8-oxo-7H-purin-9-yl]piperidine-1-carboxylate (PubChem CID 118620629) has the molecular formula C21H25FN6O3 and a molecular weight of 428.47 g/mol. Its IUPAC name is tert-butyl (3R)-3-[2-(4-fluoroanilino)-8-oxo-7H-purin-9-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[2-(4-fluoroanilino)-8-oxo-7H-purin-9-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118620629 |
| Molecular Formula | C21H25FN6O3 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | tert-butyl (3R)-3-[2-(4-fluoroanilino)-8-oxo-7H-purin-9-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](n2c(=O)[nH]c3cnc(Nc4ccc(F)cc4)nc32)C1 |
| InChI | InChI=1S/C21H25FN6O3/c1-21(2,3)31-20(30)27-10-4-5-15(12-27)28-17-16(25-19(28)29)11-23-18(26-17)24-14-8-6-13(22)7-9-14/h6-9,11,15H,4-5,10,12H2,1-3H3,(H,25,29)(H,23,24,26)/t15-/m1/s1 |
| InChIKey | OMAOZJYKHHOVLW-OAHLLOKOSA-N |
| XLogP | 3.57 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |