C35H51ClN6O6 — CID 160656647
acetyl chloride;tert-butyl (3R)-3-(2-aminoanilino)piperidine-1-carboxylate;tert-butyl (3R)-3-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate (PubChem CID 160656647) has the molecular formula C35H51ClN6O6 and a molecular weight of 687.28 g/mol. Its IUPAC name is acetyl chloride;tert-butyl (3R)-3-(2-aminoanilino)piperidine-1-carboxylate;tert-butyl (3R)-3-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate.
| Compound Name | acetyl chloride;tert-butyl (3R)-3-(2-aminoanilino)piperidine-1-carboxylate;tert-butyl (3R)-3-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 160656647 |
| Molecular Formula | C35H51ClN6O6 |
| Molecular Weight | 687.28 g/mol |
| Exact Mass | 686.36 |
| IUPAC Name | acetyl chloride;tert-butyl (3R)-3-(2-aminoanilino)piperidine-1-carboxylate;tert-butyl (3R)-3-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate |
| SMILES | CC(=O)Cl.CC(C)(C)OC(=O)N1CCC[C@@H](Nc2ccccc2N)C1.CC(C)(C)OC(=O)N1CCC[C@@H](n2c(=O)[nH]c3ccccc32)C1 |
| InChI | InChI=1S/C17H23N3O3.C16H25N3O2.C2H3ClO/c1-17(2,3)23-16(22)19-10-6-7-12(11-19)20-14-9-5-4-8-13(14)18-15(20)21;1-16(2,3)21-15(20)19-10-6-7-12(11-19)18-14-9-5-4-8-13(14)17;1-2(3)4/h4-5,8-9,12H,6-7,10-11H2,1-3H3,(H,18,21);4-5,8-9,12,18H,6-7,10-11,17H2,1-3H3;1H3/t2*12-;/m11./s1 |
| InChIKey | RLDFAWJAIBSGCP-IUWNWRFPSA-N |
| XLogP | 6.75 |
| TPSA | 151.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.28 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|