C17H18F2N6O3 — CID 71062086
2-[[5-(difluoromethyl)-2-methoxy-3-pyridinyl]amino]-9-(oxan-4-yl)-7H-purin-8-one (PubChem CID 71062086) has the molecular formula C17H18F2N6O3 and a molecular weight of 392.37 g/mol. Its IUPAC name is 2-[[5-(difluoromethyl)-2-methoxy-3-pyridinyl]amino]-9-(oxan-4-yl)-7H-purin-8-one.
| Compound Name | 2-[[5-(difluoromethyl)-2-methoxy-3-pyridinyl]amino]-9-(oxan-4-yl)-7H-purin-8-one |
|---|---|
| PubChem CID | 71062086 |
| Molecular Formula | C17H18F2N6O3 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-[[5-(difluoromethyl)-2-methoxy-3-pyridinyl]amino]-9-(oxan-4-yl)-7H-purin-8-one |
| SMILES | COc1ncc(C(F)F)cc1Nc1ncc2[nH]c(=O)n(C3CCOCC3)c2n1 |
| InChI | InChI=1S/C17H18F2N6O3/c1-27-15-11(6-9(7-20-15)13(18)19)22-16-21-8-12-14(24-16)25(17(26)23-12)10-2-4-28-5-3-10/h6-8,10,13H,2-5H2,1H3,(H,23,26)(H,21,22,24) |
| InChIKey | WBRPMJHSHRQKKK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |