C34H40N6O3Si — CID 90218331
9-[(1R,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]-2-[(2-methoxy-3-pyridinyl)amino]-7H-purin-8-one (PubChem CID 90218331) has the molecular formula C34H40N6O3Si and a molecular weight of 608.82 g/mol. Its IUPAC name is 9-[(1R,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]-2-[(2-methoxy-3-pyridinyl)amino]-7H-purin-8-one.
| Compound Name | 9-[(1R,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]-2-[(2-methoxy-3-pyridinyl)amino]-7H-purin-8-one |
|---|---|
| PubChem CID | 90218331 |
| Molecular Formula | C34H40N6O3Si |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | 9-[(1R,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]-2-[(2-methoxy-3-pyridinyl)amino]-7H-purin-8-one |
| SMILES | COc1ncccc1Nc1ncc2[nH]c(=O)n([C@@H]3CCCC[C@@H]3CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c2n1 |
| InChI | InChI=1S/C34H40N6O3Si/c1-34(2,3)44(25-15-7-5-8-16-25,26-17-9-6-10-18-26)43-23-24-14-11-12-20-29(24)40-30-28(38-33(40)41)22-36-32(39-30)37-27-19-13-21-35-31(27)42-4/h5-10,13,15-19,21-22,24,29H,11-12,14,20,23H2,1-4H3,(H,38,41)(H,36,37,39)/t24-,29-/m1/s1 |
| InChIKey | VPMRNWHBRODUFF-FUFSCUOVSA-N |
| XLogP | 5.57 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|