C32H38N6O4Si — CID 140645004
4-N-[(1S,2S)-2-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2-N-(2-methoxy-3-pyridinyl)-5-nitropyrimidine-2,4-diamine (PubChem CID 140645004) has the molecular formula C32H38N6O4Si and a molecular weight of 598.78 g/mol. Its IUPAC name is 4-N-[(1S,2S)-2-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2-N-(2-methoxy-3-pyridinyl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-[(1S,2S)-2-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2-N-(2-methoxy-3-pyridinyl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 140645004 |
| Molecular Formula | C32H38N6O4Si |
| Molecular Weight | 598.78 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | 4-N-[(1S,2S)-2-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2-N-(2-methoxy-3-pyridinyl)-5-nitropyrimidine-2,4-diamine |
| SMILES | COc1ncccc1Nc1ncc([N+](=O)[O-])c(N[C@H]2CCCC[C@@H]2O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)n1 |
| InChI | InChI=1S/C32H38N6O4Si/c1-32(2,3)43(23-14-7-5-8-15-23,24-16-9-6-10-17-24)42-28-20-12-11-18-25(28)35-29-27(38(39)40)22-34-31(37-29)36-26-19-13-21-33-30(26)41-4/h5-10,13-17,19,21-22,25,28H,11-12,18,20H2,1-4H3,(H2,34,35,36,37)/t25-,28-/m0/s1 |
| InChIKey | CRLDOKDUFXGKFH-LSYYVWMOSA-N |
| XLogP | 5.83 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.78 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|