C16H13N5O4 — CID 3615474
2-[[2-(2-hydroxyanilino)-5-nitropyrimidin-4-yl]amino]phenol (PubChem CID 3615474) has the molecular formula C16H13N5O4 and a molecular weight of 339.31 g/mol. Its IUPAC name is 2-[[2-(2-hydroxyanilino)-5-nitropyrimidin-4-yl]amino]phenol.
| Compound Name | 2-[[2-(2-hydroxyanilino)-5-nitropyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 3615474 |
| Molecular Formula | C16H13N5O4 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-[[2-(2-hydroxyanilino)-5-nitropyrimidin-4-yl]amino]phenol |
| SMILES | O=[N+]([O-])c1cnc(Nc2ccccc2O)nc1Nc1ccccc1O |
| InChI | InChI=1S/C16H13N5O4/c22-13-7-3-1-5-10(13)18-15-12(21(24)25)9-17-16(20-15)19-11-6-2-4-8-14(11)23/h1-9,22-23H,(H2,17,18,19,20) |
| InChIKey | ZZOPNOMJTCNSLW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 133.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|