C17H27N3O4Si — CID 141469854
7-(oxan-4-yloxy)-3-(2-trimethylsilylethoxymethyl)-1H-imidazo[4,5-b]pyridin-2-one (PubChem CID 141469854) has the molecular formula C17H27N3O4Si and a molecular weight of 365.51 g/mol. Its IUPAC name is 7-(oxan-4-yloxy)-3-(2-trimethylsilylethoxymethyl)-1H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 7-(oxan-4-yloxy)-3-(2-trimethylsilylethoxymethyl)-1H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 141469854 |
| Molecular Formula | C17H27N3O4Si |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 7-(oxan-4-yloxy)-3-(2-trimethylsilylethoxymethyl)-1H-imidazo[4,5-b]pyridin-2-one |
| SMILES | C[Si](C)(C)CCOCn1c(=O)[nH]c2c(OC3CCOCC3)ccnc21 |
| InChI | InChI=1S/C17H27N3O4Si/c1-25(2,3)11-10-23-12-20-16-15(19-17(20)21)14(4-7-18-16)24-13-5-8-22-9-6-13/h4,7,13H,5-6,8-12H2,1-3H3,(H,19,21) |
| InChIKey | LUCJMNWGPXEOPX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|