C22H23Cl2N5O3Si — CID 156714382
7-(4-chlorophenyl)-8-(2-chloro-3-pyridinyl)-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 156714382) has the molecular formula C22H23Cl2N5O3Si and a molecular weight of 504.45 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-8-(2-chloro-3-pyridinyl)-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 7-(4-chlorophenyl)-8-(2-chloro-3-pyridinyl)-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 156714382 |
| Molecular Formula | C22H23Cl2N5O3Si |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 7-(4-chlorophenyl)-8-(2-chloro-3-pyridinyl)-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | C[Si](C)(C)CCOCn1c(=O)[nH]c(=O)c2c1nc(-c1cccnc1Cl)n2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23Cl2N5O3Si/c1-33(2,3)12-11-32-13-28-20-17(21(30)27-22(28)31)29(15-8-6-14(23)7-9-15)19(26-20)16-5-4-10-25-18(16)24/h4-10H,11-13H2,1-3H3,(H,27,30,31) |
| InChIKey | XTRBQLHHJMITEB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|