C26H29N5O3Si — CID 58577646
7-methyl-3-[4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyphenyl]-1H-imidazo[4,5-b]pyridin-2-one (PubChem CID 58577646) has the molecular formula C26H29N5O3Si and a molecular weight of 487.64 g/mol. Its IUPAC name is 7-methyl-3-[4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyphenyl]-1H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 7-methyl-3-[4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyphenyl]-1H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 58577646 |
| Molecular Formula | C26H29N5O3Si |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 7-methyl-3-[4-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyphenyl]-1H-imidazo[4,5-b]pyridin-2-one |
| SMILES | Cc1ccnc2c1[nH]c(=O)n2-c1ccc(Oc2nc3ccccc3n2COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C26H29N5O3Si/c1-18-13-14-27-24-23(18)29-25(32)31(24)19-9-11-20(12-10-19)34-26-28-21-7-5-6-8-22(21)30(26)17-33-15-16-35(2,3)4/h5-14H,15-17H2,1-4H3,(H,29,32) |
| InChIKey | UUWXGFOBWKFAQE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|