C24H28N4O4Si — CID 67338630
2-[5-[4-(1H-pyrazol-5-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyacetic acid (PubChem CID 67338630) has the molecular formula C24H28N4O4Si and a molecular weight of 464.60 g/mol. Its IUPAC name is 2-[5-[4-(1H-pyrazol-5-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyacetic acid.
| Compound Name | 2-[5-[4-(1H-pyrazol-5-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 67338630 |
| Molecular Formula | C24H28N4O4Si |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 2-[5-[4-(1H-pyrazol-5-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxyacetic acid |
| SMILES | C[Si](C)(C)CCOCn1c(OCC(=O)O)nc2cc(-c3ccc(-c4ccn[nH]4)cc3)ccc21 |
| InChI | InChI=1S/C24H28N4O4Si/c1-33(2,3)13-12-31-16-28-22-9-8-19(14-21(22)26-24(28)32-15-23(29)30)17-4-6-18(7-5-17)20-10-11-25-27-20/h4-11,14H,12-13,15-16H2,1-3H3,(H,25,27)(H,29,30) |
| InChIKey | NGMBWMQSLBIKRL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|