C19H26ClIN2O5Si — CID 90042236
(3R,3aR,6R,6aR)-6-[6-chloro-5-iodo-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 90042236) has the molecular formula C19H26ClIN2O5Si and a molecular weight of 552.87 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[6-chloro-5-iodo-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[6-chloro-5-iodo-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 90042236 |
| Molecular Formula | C19H26ClIN2O5Si |
| Molecular Weight | 552.87 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[6-chloro-5-iodo-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | C[Si](C)(C)CCOCn1c(O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3O)nc2cc(I)c(Cl)cc21 |
| InChI | InChI=1S/C19H26ClIN2O5Si/c1-29(2,3)5-4-25-10-23-14-6-11(20)12(21)7-13(14)22-19(23)28-16-9-27-17-15(24)8-26-18(16)17/h6-7,15-18,24H,4-5,8-10H2,1-3H3/t15-,16-,17-,18-/m1/s1 |
| InChIKey | DIHXOSLPOYCNHH-BRSBDYLESA-N |
| XLogP | 3.51 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.87 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|