C24H39Cl2N3O5Si2 — CID 140941573
2-[[2-[[(3R,3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-5,6-dichloroimidazo[4,5-b]pyridin-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140941573) has the molecular formula C24H39Cl2N3O5Si2 and a molecular weight of 576.67 g/mol. Its IUPAC name is 2-[[2-[[(3R,3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-5,6-dichloroimidazo[4,5-b]pyridin-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[[(3R,3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-5,6-dichloroimidazo[4,5-b]pyridin-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140941573 |
| Molecular Formula | C24H39Cl2N3O5Si2 |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | 2-[[2-[[(3R,3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-5,6-dichloroimidazo[4,5-b]pyridin-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2cc(Cl)c(Cl)nc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H39Cl2N3O5Si2/c1-24(2,3)36(7,8)34-18-13-32-19-17(12-31-20(18)19)33-23-27-16-11-15(25)21(26)28-22(16)29(23)14-30-9-10-35(4,5)6/h11,17-20H,9-10,12-14H2,1-8H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | UZPNDLDYNDZXQY-UAFMIMERSA-N |
| XLogP | 5.99 |
| TPSA | 76.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|