C24H41ClN4O5Si2 — CID 140941574
2-[[(3R,3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-6-chloro-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-5-amine (PubChem CID 140941574) has the molecular formula C24H41ClN4O5Si2 and a molecular weight of 557.24 g/mol. Its IUPAC name is 2-[[(3R,3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-6-chloro-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-[[(3R,3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-6-chloro-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 140941574 |
| Molecular Formula | C24H41ClN4O5Si2 |
| Molecular Weight | 557.24 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | 2-[[(3R,3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-6-chloro-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-5-amine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2cc(Cl)c(N)nc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H41ClN4O5Si2/c1-24(2,3)36(7,8)34-18-13-32-19-17(12-31-20(18)19)33-23-27-16-11-15(25)21(26)28-22(16)29(23)14-30-9-10-35(4,5)6/h11,17-20H,9-10,12-14H2,1-8H3,(H2,26,28)/t17-,18-,19-,20-/m1/s1 |
| InChIKey | LDJXXEBOAYMUQK-UAFMIMERSA-N |
| XLogP | 4.91 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.24 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|