C18H25ClIN3O5Si — CID 131741854
6-[6-chloro-5-iodo-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 131741854) has the molecular formula C18H25ClIN3O5Si and a molecular weight of 553.86 g/mol. Its IUPAC name is 6-[6-chloro-5-iodo-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | 6-[6-chloro-5-iodo-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 131741854 |
| Molecular Formula | C18H25ClIN3O5Si |
| Molecular Weight | 553.86 g/mol |
| Exact Mass | 553.03 |
| IUPAC Name | 6-[6-chloro-5-iodo-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | C[Si](C)(C)CCOCn1c(OC2COC3C(O)COC23)nc2cc(Cl)c(I)nc21 |
| InChI | InChI=1S/C18H25ClIN3O5Si/c1-29(2,3)5-4-25-9-23-17-11(6-10(19)16(20)22-17)21-18(23)28-13-8-27-14-12(24)7-26-15(13)14/h6,12-15,24H,4-5,7-9H2,1-3H3 |
| InChIKey | JNNUCBXQAMEEBI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 87.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.86 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|