C30H33BrFN3O5Si — CID 140810815
(3R,3aR,6R,6aR)-6-[5-[4-(5-bromo-2-pyridinyl)phenyl]-6-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 140810815) has the molecular formula C30H33BrFN3O5Si and a molecular weight of 642.60 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[5-[4-(5-bromo-2-pyridinyl)phenyl]-6-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[5-[4-(5-bromo-2-pyridinyl)phenyl]-6-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 140810815 |
| Molecular Formula | C30H33BrFN3O5Si |
| Molecular Weight | 642.60 g/mol |
| Exact Mass | 641.14 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[5-[4-(5-bromo-2-pyridinyl)phenyl]-6-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | C[Si](C)(C)CCOCn1c(O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3O)cc2nc(-c3ccc(-c4ccc(Br)cn4)cc3)c(F)cc21 |
| InChI | InChI=1S/C30H33BrFN3O5Si/c1-41(2,3)11-10-37-17-35-24-12-21(32)28(19-6-4-18(5-7-19)22-9-8-20(31)14-33-22)34-23(24)13-27(35)40-26-16-39-29-25(36)15-38-30(26)29/h4-9,12-14,25-26,29-30,36H,10-11,15-17H2,1-3H3/t25-,26-,29-,30-/m1/s1 |
| InChIKey | HOLWPSQQIKQKJP-OIWKEWRZSA-N |
| XLogP | 5.89 |
| TPSA | 87.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|