C13H11BrF2N2O4S — CID 145024182
[2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-bromo-6-fluoropyrrolo[3,2-b]pyridin-1-yl] thiohypofluorite (PubChem CID 145024182) has the molecular formula C13H11BrF2N2O4S and a molecular weight of 409.21 g/mol. Its IUPAC name is [2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-bromo-6-fluoropyrrolo[3,2-b]pyridin-1-yl] thiohypofluorite.
| Compound Name | [2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-bromo-6-fluoropyrrolo[3,2-b]pyridin-1-yl] thiohypofluorite |
|---|---|
| PubChem CID | 145024182 |
| Molecular Formula | C13H11BrF2N2O4S |
| Molecular Weight | 409.21 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | [2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-bromo-6-fluoropyrrolo[3,2-b]pyridin-1-yl] thiohypofluorite |
| SMILES | O[C@@H]1CO[C@H]2C1OC[C@H]2Oc1cc2nc(Br)c(F)cc2n1SF |
| InChI | InChI=1S/C13H11BrF2N2O4S/c14-13-5(15)1-7-6(17-13)2-10(18(7)23-16)22-9-4-21-11-8(19)3-20-12(9)11/h1-2,8-9,11-12,19H,3-4H2/t8-,9-,11?,12-/m1/s1 |
| InChIKey | YGDDYJHCOFMCRZ-VHKWXXMASA-N |
| XLogP | 2.22 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|