C30H30FIN3O5P — CID 145357729
(3R,6R,6aR)-6-[6-fluoro-1-iodophosphanyl-5-[4-[4-(1-methylpyrrolidin-3-yl)oxyphenyl]phenyl]pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 145357729) has the molecular formula C30H30FIN3O5P and a molecular weight of 689.46 g/mol. Its IUPAC name is (3R,6R,6aR)-6-[6-fluoro-1-iodophosphanyl-5-[4-[4-(1-methylpyrrolidin-3-yl)oxyphenyl]phenyl]pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,6R,6aR)-6-[6-fluoro-1-iodophosphanyl-5-[4-[4-(1-methylpyrrolidin-3-yl)oxyphenyl]phenyl]pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 145357729 |
| Molecular Formula | C30H30FIN3O5P |
| Molecular Weight | 689.46 g/mol |
| Exact Mass | 689.10 |
| IUPAC Name | (3R,6R,6aR)-6-[6-fluoro-1-iodophosphanyl-5-[4-[4-(1-methylpyrrolidin-3-yl)oxyphenyl]phenyl]pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | CN1CCC(Oc2ccc(-c3ccc(-c4nc5cc(O[C@@H]6COC7[C@H](O)CO[C@@H]76)n(PI)c5cc4F)cc3)cc2)C1 |
| InChI | InChI=1S/C30H30FIN3O5P/c1-34-11-10-21(14-34)39-20-8-6-18(7-9-20)17-2-4-19(5-3-17)28-22(31)12-24-23(33-28)13-27(35(24)41-32)40-26-16-38-29-25(36)15-37-30(26)29/h2-9,12-13,21,25-26,29-30,36,41H,10-11,14-16H2,1H3/t21?,25-,26-,29?,30-/m1/s1 |
| InChIKey | GNUKFNCMOAUCIG-ZLDGKCCRSA-N |
| XLogP | 5.29 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|