C29H24F2N2O5S — CID 145024270
[2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-[4-(2-benzoylcyclopropyl)phenyl]-6-fluoropyrrolo[3,2-b]pyridin-1-yl] thiohypofluorite (PubChem CID 145024270) has the molecular formula C29H24F2N2O5S and a molecular weight of 550.58 g/mol. Its IUPAC name is [2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-[4-(2-benzoylcyclopropyl)phenyl]-6-fluoropyrrolo[3,2-b]pyridin-1-yl] thiohypofluorite.
| Compound Name | [2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-[4-(2-benzoylcyclopropyl)phenyl]-6-fluoropyrrolo[3,2-b]pyridin-1-yl] thiohypofluorite |
|---|---|
| PubChem CID | 145024270 |
| Molecular Formula | C29H24F2N2O5S |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | [2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-[4-(2-benzoylcyclopropyl)phenyl]-6-fluoropyrrolo[3,2-b]pyridin-1-yl] thiohypofluorite |
| SMILES | O=C(c1ccccc1)C1CC1c1ccc(-c2nc3cc(O[C@@H]4COC5[C@H](O)CO[C@@H]54)n(SF)c3cc2F)cc1 |
| InChI | InChI=1S/C29H24F2N2O5S/c30-20-11-22-21(12-25(33(22)39-31)38-24-14-37-28-23(34)13-36-29(24)28)32-26(20)16-8-6-15(7-9-16)18-10-19(18)27(35)17-4-2-1-3-5-17/h1-9,11-12,18-19,23-24,28-29,34H,10,13-14H2/t18?,19?,23-,24-,28?,29-/m1/s1 |
| InChIKey | IDODLCXXXFXRRK-FIAOBKHVSA-N |
| XLogP | 5.12 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |