C31H31FN2O6S — CID 130378297
(3R,3aR,6R,6aR)-6-[6-fluoro-5-[4-(4-methylsulfinylphenyl)phenyl]-1-(oxan-2-yl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 130378297) has the molecular formula C31H31FN2O6S and a molecular weight of 578.66 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[6-fluoro-5-[4-(4-methylsulfinylphenyl)phenyl]-1-(oxan-2-yl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[6-fluoro-5-[4-(4-methylsulfinylphenyl)phenyl]-1-(oxan-2-yl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 130378297 |
| Molecular Formula | C31H31FN2O6S |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[6-fluoro-5-[4-(4-methylsulfinylphenyl)phenyl]-1-(oxan-2-yl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | CS(=O)c1ccc(-c2ccc(-c3nc4cc(O[C@@H]5CO[C@H]6[C@@H]5OC[C@H]6O)n(C5CCCCO5)c4cc3F)cc2)cc1 |
| InChI | InChI=1S/C31H31FN2O6S/c1-41(36)21-11-9-19(10-12-21)18-5-7-20(8-6-18)29-22(32)14-24-23(33-29)15-28(34(24)27-4-2-3-13-37-27)40-26-17-39-30-25(35)16-38-31(26)30/h5-12,14-15,25-27,30-31,35H,2-4,13,16-17H2,1H3/t25-,26-,27?,30-,31-,41?/m1/s1 |
| InChIKey | ULUDDROLPNURJK-XIMMDKSVSA-N |
| XLogP | 4.85 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |