C29H30FNO5S — CID 145357667
(3R,3aR,6R,6aR)-6-[(E)-1-[5-fluoro-3-methyl-6-[4-(4-methylsulfinylphenyl)phenyl]-2-pyridinyl]but-1-en-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 145357667) has the molecular formula C29H30FNO5S and a molecular weight of 523.63 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[(E)-1-[5-fluoro-3-methyl-6-[4-(4-methylsulfinylphenyl)phenyl]-2-pyridinyl]but-1-en-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[(E)-1-[5-fluoro-3-methyl-6-[4-(4-methylsulfinylphenyl)phenyl]-2-pyridinyl]but-1-en-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 145357667 |
| Molecular Formula | C29H30FNO5S |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[(E)-1-[5-fluoro-3-methyl-6-[4-(4-methylsulfinylphenyl)phenyl]-2-pyridinyl]but-1-en-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | CC/C(=C\c1nc(-c2ccc(-c3ccc(S(C)=O)cc3)cc2)c(F)cc1C)O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2O |
| InChI | InChI=1S/C29H30FNO5S/c1-4-21(36-26-16-35-28-25(32)15-34-29(26)28)14-24-17(2)13-23(30)27(31-24)20-7-5-18(6-8-20)19-9-11-22(12-10-19)37(3)33/h5-14,25-26,28-29,32H,4,15-16H2,1-3H3/b21-14+/t25-,26-,28-,29-,37?/m1/s1 |
| InChIKey | NWGOEBANXHPHJD-BERVULAXSA-N |
| XLogP | 4.90 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|