C28H30FN3O5S — CID 145357586
(3aR,6aR)-6-[[5-[4-(4-amino-2-methylphenyl)phenyl]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;methylsulfinylmethane (PubChem CID 145357586) has the molecular formula C28H30FN3O5S and a molecular weight of 539.63 g/mol. Its IUPAC name is (3aR,6aR)-6-[[5-[4-(4-amino-2-methylphenyl)phenyl]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;methylsulfinylmethane.
| Compound Name | (3aR,6aR)-6-[[5-[4-(4-amino-2-methylphenyl)phenyl]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;methylsulfinylmethane |
|---|---|
| PubChem CID | 145357586 |
| Molecular Formula | C28H30FN3O5S |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | (3aR,6aR)-6-[[5-[4-(4-amino-2-methylphenyl)phenyl]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;methylsulfinylmethane |
| SMILES | CS(C)=O.Cc1cc(N)ccc1-c1ccc(-c2nc3cc(OC4CO[C@@H]5C(O)CO[C@H]45)[nH]c3cc2F)cc1 |
| InChI | InChI=1S/C26H24FN3O4.C2H6OS/c1-13-8-16(28)6-7-17(13)14-2-4-15(5-3-14)24-18(27)9-19-20(30-24)10-23(29-19)34-22-12-33-25-21(31)11-32-26(22)25;1-4(2)3/h2-10,21-22,25-26,29,31H,11-12,28H2,1H3;1-2H3/t21?,22?,25-,26-;/m1./s1 |
| InChIKey | FBHXPKVUTCYPGF-BKOZTLFKSA-N |
| XLogP | 3.83 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|