C23H24FN3O5 — CID 145024049
1-[4-[2-[[(6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]pyrrolidin-3-ol (PubChem CID 145024049) has the molecular formula C23H24FN3O5 and a molecular weight of 441.46 g/mol. Its IUPAC name is 1-[4-[2-[[(6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]pyrrolidin-3-ol.
| Compound Name | 1-[4-[2-[[(6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 145024049 |
| Molecular Formula | C23H24FN3O5 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 1-[4-[2-[[(6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]pyrrolidin-3-ol |
| SMILES | OC1CCN(c2ccc(-c3nc4cc(OC5COC6C(O)CO[C@H]56)[nH]c4cc3F)cc2)C1 |
| InChI | InChI=1S/C23H24FN3O5/c24-15-7-16-17(8-20(25-16)32-19-11-31-22-18(29)10-30-23(19)22)26-21(15)12-1-3-13(4-2-12)27-6-5-14(28)9-27/h1-4,7-8,14,18-19,22-23,25,28-29H,5-6,9-11H2/t14?,18?,19?,22?,23-/m1/s1 |
| InChIKey | WISWAUGIZDXEAJ-OJAIQOJNSA-N |
| XLogP | 1.85 |
| TPSA | 100.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |