C37H30FN3O5S — CID 118908862
(3R,3aR,6R,6aR)-6-[[6-fluoro-5-[4-[4-[[oxo(diphenyl)-λ6-sulfanylidene]amino]phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 118908862) has the molecular formula C37H30FN3O5S and a molecular weight of 647.73 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-fluoro-5-[4-[4-[[oxo(diphenyl)-λ6-sulfanylidene]amino]phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-fluoro-5-[4-[4-[[oxo(diphenyl)-λ6-sulfanylidene]amino]phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 118908862 |
| Molecular Formula | C37H30FN3O5S |
| Molecular Weight | 647.73 g/mol |
| Exact Mass | 647.19 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-fluoro-5-[4-[4-[[oxo(diphenyl)-λ6-sulfanylidene]amino]phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O=S(=Nc1ccc(-c2ccc(-c3nc4cc(O[C@@H]5CO[C@H]6[C@@H]5OC[C@H]6O)[nH]c4cc3F)cc2)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H30FN3O5S/c38-29-19-30-31(20-34(39-30)46-33-22-45-36-32(42)21-44-37(33)36)40-35(29)25-13-11-23(12-14-25)24-15-17-26(18-16-24)41-47(43,27-7-3-1-4-8-27)28-9-5-2-6-10-28/h1-20,32-33,36-37,39,42H,21-22H2/t32-,33-,36-,37-/m1/s1 |
| InChIKey | ZAUFRRQNTNDNJX-JQNMBPESSA-N |
| XLogP | 7.16 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.73 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |